C29H26N8O2 — CID 132527591
1-(2,8,14,20-tetramethyl-2,8,14,20,25,26,27-heptazapentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaen-28-yl)pyrrole-2,5-dione (PubChem CID 132527591) has the molecular formula C29H26N8O2 and a molecular weight of 518.58 g/mol. Its IUPAC name is 1-(2,8,14,20-tetramethyl-2,8,14,20,25,26,27-heptazapentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaen-28-yl)pyrrole-2,5-dione.
| Compound Name | 1-(2,8,14,20-tetramethyl-2,8,14,20,25,26,27-heptazapentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaen-28-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 132527591 |
| Molecular Formula | C29H26N8O2 |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 1-(2,8,14,20-tetramethyl-2,8,14,20,25,26,27-heptazapentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaen-28-yl)pyrrole-2,5-dione |
| SMILES | CN1c2cccc(n2)N(C)c2cccc(n2)N(C)c2cccc(c2N2C(=O)C=CC2=O)N(C)c2cccc1n2 |
| InChI | InChI=1S/C29H26N8O2/c1-33-19-9-5-10-20(29(19)37-27(38)17-18-28(37)39)34(2)22-12-7-14-24(31-22)36(4)26-16-8-15-25(32-26)35(3)23-13-6-11-21(33)30-23/h5-18H,1-4H3 |
| InChIKey | DOWYBBAQQDZYLA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 89.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|