C22H16O2 — CID 132527641
1-(9H-fluoren-2-yl)-3-phenylpropane-1,3-dione (PubChem CID 132527641) has the molecular formula C22H16O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 1-(9H-fluoren-2-yl)-3-phenylpropane-1,3-dione.
| Compound Name | 1-(9H-fluoren-2-yl)-3-phenylpropane-1,3-dione |
|---|---|
| PubChem CID | 132527641 |
| Molecular Formula | C22H16O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 1-(9H-fluoren-2-yl)-3-phenylpropane-1,3-dione |
| SMILES | O=C(CC(=O)c1ccc2c(c1)Cc1ccccc1-2)c1ccccc1 |
| InChI | InChI=1S/C22H16O2/c23-21(15-6-2-1-3-7-15)14-22(24)17-10-11-20-18(13-17)12-16-8-4-5-9-19(16)20/h1-11,13H,12,14H2 |
| InChIKey | KKWAWQZRQFTZIF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|