About (4Z)-2-benzyl-4-benzylidene-3H-1λ6,2-benzothiazine 1,1-dioxide
(4Z)-2-benzyl-4-benzylidene-3H-1λ6,2-benzothiazine 1,1-dioxide (PubChem CID 132527658) has the molecular formula C22H19NO2S
and a molecular weight of 361.47 g/mol. Its IUPAC name is (4Z)-2-benzyl-4-benzylidene-3H-1λ6,2-benzothiazine 1,1-dioxide.
Molecular Properties
| Compound Name | (4Z)-2-benzyl-4-benzylidene-3H-1λ6,2-benzothiazine 1,1-dioxide |
| PubChem CID | 132527658 |
| Molecular Formula | C22H19NO2S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | (4Z)-2-benzyl-4-benzylidene-3H-1λ6,2-benzothiazine 1,1-dioxide |
| SMILES | O=S1(=O)c2ccccc2/C(=C/c2ccccc2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C22H19NO2S/c24-26(25)22-14-8-7-13-21(22)20(15-18-9-3-1-4-10-18)17-23(26)16-19-11-5-2-6-12-19/h1-15H,16-17H2/b20-15+ |
| InChIKey | JCAHFOOGBNGCTH-HMMYKYKNSA-N |
| XLogP | 4.43 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-2-benzyl-4-benzylidene-3H-1λ6,2-benzothiazine 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-2-benzyl-4-benzylidene-3H-1λ6,2-benzothiazine 1,1-dioxide?
The IUPAC name of (4Z)-2-benzyl-4-benzylidene-3H-1λ6,2-benzothiazine 1,1-dioxide (CID 132527658) is (4Z)-2-benzyl-4-benzylidene-3H-1λ6,2-benzothiazine 1,1-dioxide.
What is the SMILES notation for (4Z)-2-benzyl-4-benzylidene-3H-1λ6,2-benzothiazine 1,1-dioxide?
The canonical SMILES for (4Z)-2-benzyl-4-benzylidene-3H-1λ6,2-benzothiazine 1,1-dioxide is O=S1(=O)c2ccccc2/C(=C/c2ccccc2)CN1Cc1ccccc1.
What is the InChIKey of (4Z)-2-benzyl-4-benzylidene-3H-1λ6,2-benzothiazine 1,1-dioxide?
The InChIKey is JCAHFOOGBNGCTH-HMMYKYKNSA-N. The full InChI is InChI=1S/C22H19NO2S/c24-26(25)22-14-8-7-13-21(22)20(15-18-9-3-1-4-10-18)17-23(26)16-19-11-5-2-6-12-19/h1-15H,16-17H2/b20-15+.
What are the key properties of (4Z)-2-benzyl-4-benzylidene-3H-1λ6,2-benzothiazine 1,1-dioxide?
(4Z)-2-benzyl-4-benzylidene-3H-1λ6,2-benzothiazine 1,1-dioxide has a molecular weight of 361.47 g/mol, XLogP of 4.43, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-2-benzyl-4-benzylidene-3H-1λ6,2-benzothiazine 1,1-dioxide is sourced from PubChem (CID 132527658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).