C34H38N6O5 — CID 132527882
5-[2-[(1-benzyltriazol-4-yl)methoxy]-3-methoxyphenyl]-2-cyclohexyl-8,8-dimethyl-7,9-dihydro-5H-[1,2,4]triazolo[1,2-a]indazole-1,3,6-trione (PubChem CID 132527882) has the molecular formula C34H38N6O5 and a molecular weight of 610.72 g/mol. Its IUPAC name is 5-[2-[(1-benzyltriazol-4-yl)methoxy]-3-methoxyphenyl]-2-cyclohexyl-8,8-dimethyl-7,9-dihydro-5H-[1,2,4]triazolo[1,2-a]indazole-1,3,6-trione.
| Compound Name | 5-[2-[(1-benzyltriazol-4-yl)methoxy]-3-methoxyphenyl]-2-cyclohexyl-8,8-dimethyl-7,9-dihydro-5H-[1,2,4]triazolo[1,2-a]indazole-1,3,6-trione |
|---|---|
| PubChem CID | 132527882 |
| Molecular Formula | C34H38N6O5 |
| Molecular Weight | 610.72 g/mol |
| Exact Mass | 610.29 |
| IUPAC Name | 5-[2-[(1-benzyltriazol-4-yl)methoxy]-3-methoxyphenyl]-2-cyclohexyl-8,8-dimethyl-7,9-dihydro-5H-[1,2,4]triazolo[1,2-a]indazole-1,3,6-trione |
| SMILES | COc1cccc(C2C3=C(CC(C)(C)CC3=O)n3c(=O)n(C4CCCCC4)c(=O)n32)c1OCc1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C34H38N6O5/c1-34(2)17-26-29(27(41)18-34)30(40-33(43)38(32(42)39(26)40)24-13-8-5-9-14-24)25-15-10-16-28(44-3)31(25)45-21-23-20-37(36-35-23)19-22-11-6-4-7-12-22/h4,6-7,10-12,15-16,20,24,30H,5,8-9,13-14,17-19,21H2,1-3H3 |
| InChIKey | GJLUNXBVSNNTCP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 115.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.72 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |