C27H28FN2O3P — CID 132528044
propan-2-yl (4R,5S)-1-diphenylphosphoryl-5-(4-fluorophenyl)-4,5-dimethylimidazole-4-carboxylate (PubChem CID 132528044) has the molecular formula C27H28FN2O3P and a molecular weight of 478.50 g/mol. Its IUPAC name is propan-2-yl (4R,5S)-1-diphenylphosphoryl-5-(4-fluorophenyl)-4,5-dimethylimidazole-4-carboxylate.
| Compound Name | propan-2-yl (4R,5S)-1-diphenylphosphoryl-5-(4-fluorophenyl)-4,5-dimethylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 132528044 |
| Molecular Formula | C27H28FN2O3P |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | propan-2-yl (4R,5S)-1-diphenylphosphoryl-5-(4-fluorophenyl)-4,5-dimethylimidazole-4-carboxylate |
| SMILES | CC(C)OC(=O)[C@]1(C)N=CN(P(=O)(c2ccccc2)c2ccccc2)[C@@]1(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H28FN2O3P/c1-20(2)33-25(31)26(3)27(4,21-15-17-22(28)18-16-21)30(19-29-26)34(32,23-11-7-5-8-12-23)24-13-9-6-10-14-24/h5-20H,1-4H3/t26-,27-/m0/s1 |
| InChIKey | GCZGDTZBVOQNSL-SVBPBHIXSA-N |
| XLogP | 5.02 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|