About (2R,3S)-1,3-diphenyl-2-[4-(trifluoromethyl)phenyl]pyrrolidin-3-ol
(2R,3S)-1,3-diphenyl-2-[4-(trifluoromethyl)phenyl]pyrrolidin-3-ol (PubChem CID 132528343) has the molecular formula C23H20F3NO
and a molecular weight of 383.41 g/mol. Its IUPAC name is (2R,3S)-1,3-diphenyl-2-[4-(trifluoromethyl)phenyl]pyrrolidin-3-ol.
Molecular Properties
| Compound Name | (2R,3S)-1,3-diphenyl-2-[4-(trifluoromethyl)phenyl]pyrrolidin-3-ol |
| PubChem CID | 132528343 |
| Molecular Formula | C23H20F3NO |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | (2R,3S)-1,3-diphenyl-2-[4-(trifluoromethyl)phenyl]pyrrolidin-3-ol |
| SMILES | O[C@]1(c2ccccc2)CCN(c2ccccc2)[C@@H]1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H20F3NO/c24-23(25,26)19-13-11-17(12-14-19)21-22(28,18-7-3-1-4-8-18)15-16-27(21)20-9-5-2-6-10-20/h1-14,21,28H,15-16H2/t21-,22+/m1/s1 |
| InChIKey | WUYLDRFCNAKLCF-YADHBBJMSA-N |
| XLogP | 5.54 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R,3S)-1,3-diphenyl-2-[4-(trifluoromethyl)phenyl]pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-1,3-diphenyl-2-[4-(trifluoromethyl)phenyl]pyrrolidin-3-ol?
The IUPAC name of (2R,3S)-1,3-diphenyl-2-[4-(trifluoromethyl)phenyl]pyrrolidin-3-ol (CID 132528343) is (2R,3S)-1,3-diphenyl-2-[4-(trifluoromethyl)phenyl]pyrrolidin-3-ol.
What is the SMILES notation for (2R,3S)-1,3-diphenyl-2-[4-(trifluoromethyl)phenyl]pyrrolidin-3-ol?
The canonical SMILES for (2R,3S)-1,3-diphenyl-2-[4-(trifluoromethyl)phenyl]pyrrolidin-3-ol is O[C@]1(c2ccccc2)CCN(c2ccccc2)[C@@H]1c1ccc(C(F)(F)F)cc1.
What is the InChIKey of (2R,3S)-1,3-diphenyl-2-[4-(trifluoromethyl)phenyl]pyrrolidin-3-ol?
The InChIKey is WUYLDRFCNAKLCF-YADHBBJMSA-N. The full InChI is InChI=1S/C23H20F3NO/c24-23(25,26)19-13-11-17(12-14-19)21-22(28,18-7-3-1-4-8-18)15-16-27(21)20-9-5-2-6-10-20/h1-14,21,28H,15-16H2/t21-,22+/m1/s1.
What are the key properties of (2R,3S)-1,3-diphenyl-2-[4-(trifluoromethyl)phenyl]pyrrolidin-3-ol?
(2R,3S)-1,3-diphenyl-2-[4-(trifluoromethyl)phenyl]pyrrolidin-3-ol has a molecular weight of 383.41 g/mol, XLogP of 5.54, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-1,3-diphenyl-2-[4-(trifluoromethyl)phenyl]pyrrolidin-3-ol is sourced from PubChem (CID 132528343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).