C26H34F3NO4S — CID 132528700
phenyl (2S)-2-hexyl-8a-prop-2-enyl-4-(trifluoromethylsulfonyl)-2,3,5,6,7,8-hexahydroquinoline-1-carboxylate (PubChem CID 132528700) has the molecular formula C26H34F3NO4S and a molecular weight of 513.62 g/mol. Its IUPAC name is phenyl (2S)-2-hexyl-8a-prop-2-enyl-4-(trifluoromethylsulfonyl)-2,3,5,6,7,8-hexahydroquinoline-1-carboxylate.
| Compound Name | phenyl (2S)-2-hexyl-8a-prop-2-enyl-4-(trifluoromethylsulfonyl)-2,3,5,6,7,8-hexahydroquinoline-1-carboxylate |
|---|---|
| PubChem CID | 132528700 |
| Molecular Formula | C26H34F3NO4S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | phenyl (2S)-2-hexyl-8a-prop-2-enyl-4-(trifluoromethylsulfonyl)-2,3,5,6,7,8-hexahydroquinoline-1-carboxylate |
| SMILES | C=CCC12CCCCC1=C(S(=O)(=O)C(F)(F)F)C[C@H](CCCCCC)N2C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C26H34F3NO4S/c1-3-5-6-8-13-20-19-23(35(32,33)26(27,28)29)22-16-11-12-18-25(22,17-4-2)30(20)24(31)34-21-14-9-7-10-15-21/h4,7,9-10,14-15,20H,2-3,5-6,8,11-13,16-19H2,1H3/t20-,25?/m0/s1 |
| InChIKey | YCHPTKHVQCAIIZ-JINQPTGOSA-N |
| XLogP | 7.31 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|