C15H19NO6S — CID 132529289
N-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylphenyl]prop-2-enamide (PubChem CID 132529289) has the molecular formula C15H19NO6S and a molecular weight of 341.39 g/mol. Its IUPAC name is N-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylphenyl]prop-2-enamide.
| Compound Name | N-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 132529289 |
| Molecular Formula | C15H19NO6S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | N-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(S[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C15H19NO6S/c1-2-11(18)16-8-3-5-9(6-4-8)23-15-14(21)13(20)12(19)10(7-17)22-15/h2-6,10,12-15,17,19-21H,1,7H2,(H,16,18)/t10-,12-,13+,14+,15-/m1/s1 |
| InChIKey | IGFRSDTXDGTRNH-JSFFLRCESA-N |
| XLogP | -0.30 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|