C41H43NO7S — CID 132529485
N-benzyl-N-[(1S,2S,3R,4R,5S,6R)-2,3-dihydroxy-4,5,6-tris(phenylmethoxy)cyclohexyl]-4-methylbenzenesulfonamide (PubChem CID 132529485) has the molecular formula C41H43NO7S and a molecular weight of 693.86 g/mol. Its IUPAC name is N-benzyl-N-[(1S,2S,3R,4R,5S,6R)-2,3-dihydroxy-4,5,6-tris(phenylmethoxy)cyclohexyl]-4-methylbenzenesulfonamide.
| Compound Name | N-benzyl-N-[(1S,2S,3R,4R,5S,6R)-2,3-dihydroxy-4,5,6-tris(phenylmethoxy)cyclohexyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 132529485 |
| Molecular Formula | C41H43NO7S |
| Molecular Weight | 693.86 g/mol |
| Exact Mass | 693.28 |
| IUPAC Name | N-benzyl-N-[(1S,2S,3R,4R,5S,6R)-2,3-dihydroxy-4,5,6-tris(phenylmethoxy)cyclohexyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2ccccc2)[C@H]2[C@H](O)[C@@H](O)[C@@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C41H43NO7S/c1-30-22-24-35(25-23-30)50(45,46)42(26-31-14-6-2-7-15-31)36-37(43)38(44)40(48-28-33-18-10-4-11-19-33)41(49-29-34-20-12-5-13-21-34)39(36)47-27-32-16-8-3-9-17-32/h2-25,36-41,43-44H,26-29H2,1H3/t36-,37-,38+,39+,40+,41-/m0/s1 |
| InChIKey | AHIIWEIENDFDLB-IJHQBPRHSA-N |
| XLogP | 6.05 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.86 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |