About 1-benzyl-4-chlorobenzene
1-benzyl-4-chlorobenzene (PubChem CID 13253) has the molecular formula C13H11Cl
and a molecular weight of 202.68 g/mol. Its IUPAC name is 1-benzyl-4-chlorobenzene.
Molecular Properties
| Compound Name | 1-benzyl-4-chlorobenzene |
| PubChem CID | 13253 |
| Molecular Formula | C13H11Cl |
| Molecular Weight | 202.68 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 1-benzyl-4-chlorobenzene |
| SMILES | Clc1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C13H11Cl/c14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | NPOGRKGIBGKRNI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.68 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-benzyl-4-chlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-chlorobenzene?
The IUPAC name of 1-benzyl-4-chlorobenzene (CID 13253) is 1-benzyl-4-chlorobenzene.
What is the SMILES notation for 1-benzyl-4-chlorobenzene?
The canonical SMILES for 1-benzyl-4-chlorobenzene is Clc1ccc(Cc2ccccc2)cc1.
What is the InChIKey of 1-benzyl-4-chlorobenzene?
The InChIKey is NPOGRKGIBGKRNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11Cl/c14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10H2.
What are the key properties of 1-benzyl-4-chlorobenzene?
1-benzyl-4-chlorobenzene has a molecular weight of 202.68 g/mol, XLogP of 3.93, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-chlorobenzene is sourced from PubChem (CID 13253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).