C10H10FNO2 — CID 132530333
2-(4-fluorophenyl)-4-methoxy-4,5-dihydro-1,3-oxazole (PubChem CID 132530333) has the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-methoxy-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(4-fluorophenyl)-4-methoxy-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 132530333 |
| Molecular Formula | C10H10FNO2 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 2-(4-fluorophenyl)-4-methoxy-4,5-dihydro-1,3-oxazole |
| SMILES | COC1COC(c2ccc(F)cc2)=N1 |
| InChI | InChI=1S/C10H10FNO2/c1-13-9-6-14-10(12-9)7-2-4-8(11)5-3-7/h2-5,9H,6H2,1H3 |
| InChIKey | GNVDCYBHCBAAAZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |