About 6-methyl-2-methylsulfanyl-5-sulfanylidene-4H-[1,3]thiazolo[5,4-d]pyrimidin-7-one
6-methyl-2-methylsulfanyl-5-sulfanylidene-4H-[1,3]thiazolo[5,4-d]pyrimidin-7-one (PubChem CID 13253039) has the molecular formula C7H7N3OS3
and a molecular weight of 245.35 g/mol. Its IUPAC name is 6-methyl-2-methylsulfanyl-5-sulfanylidene-4H-[1,3]thiazolo[5,4-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 6-methyl-2-methylsulfanyl-5-sulfanylidene-4H-[1,3]thiazolo[5,4-d]pyrimidin-7-one |
| PubChem CID | 13253039 |
| Molecular Formula | C7H7N3OS3 |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 244.98 |
| IUPAC Name | 6-methyl-2-methylsulfanyl-5-sulfanylidene-4H-[1,3]thiazolo[5,4-d]pyrimidin-7-one |
| SMILES | CSc1nc2c(=O)n(C)c(=S)[nH]c2s1 |
| InChI | InChI=1S/C7H7N3OS3/c1-10-5(11)3-4(9-6(10)12)14-7(8-3)13-2/h1-2H3,(H,9,12) |
| InChIKey | CAEMCVLSQQHKRL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-2-methylsulfanyl-5-sulfanylidene-4H-[1,3]thiazolo[5,4-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-methylsulfanyl-5-sulfanylidene-4H-[1,3]thiazolo[5,4-d]pyrimidin-7-one?
The IUPAC name of 6-methyl-2-methylsulfanyl-5-sulfanylidene-4H-[1,3]thiazolo[5,4-d]pyrimidin-7-one (CID 13253039) is 6-methyl-2-methylsulfanyl-5-sulfanylidene-4H-[1,3]thiazolo[5,4-d]pyrimidin-7-one.
What is the SMILES notation for 6-methyl-2-methylsulfanyl-5-sulfanylidene-4H-[1,3]thiazolo[5,4-d]pyrimidin-7-one?
The canonical SMILES for 6-methyl-2-methylsulfanyl-5-sulfanylidene-4H-[1,3]thiazolo[5,4-d]pyrimidin-7-one is CSc1nc2c(=O)n(C)c(=S)[nH]c2s1.
What is the InChIKey of 6-methyl-2-methylsulfanyl-5-sulfanylidene-4H-[1,3]thiazolo[5,4-d]pyrimidin-7-one?
The InChIKey is CAEMCVLSQQHKRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3OS3/c1-10-5(11)3-4(9-6(10)12)14-7(8-3)13-2/h1-2H3,(H,9,12).
What are the key properties of 6-methyl-2-methylsulfanyl-5-sulfanylidene-4H-[1,3]thiazolo[5,4-d]pyrimidin-7-one?
6-methyl-2-methylsulfanyl-5-sulfanylidene-4H-[1,3]thiazolo[5,4-d]pyrimidin-7-one has a molecular weight of 245.35 g/mol, XLogP of 1.77, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-methylsulfanyl-5-sulfanylidene-4H-[1,3]thiazolo[5,4-d]pyrimidin-7-one is sourced from PubChem (CID 13253039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).