C22H18N4 — CID 132530622
3,6-diphenyl-4-propyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile (PubChem CID 132530622) has the molecular formula C22H18N4 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3,6-diphenyl-4-propyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile.
| Compound Name | 3,6-diphenyl-4-propyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 132530622 |
| Molecular Formula | C22H18N4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 3,6-diphenyl-4-propyl-2H-pyrazolo[3,4-b]pyridine-5-carbonitrile |
| SMILES | CCCc1c(C#N)c(-c2ccccc2)nc2n[nH]c(-c3ccccc3)c12 |
| InChI | InChI=1S/C22H18N4/c1-2-9-17-18(14-23)20(15-10-5-3-6-11-15)24-22-19(17)21(25-26-22)16-12-7-4-8-13-16/h3-8,10-13H,2,9H2,1H3,(H,24,25,26) |
| InChIKey | OWHLZKYXXOIHCQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |