About [2-[1-(1,1-dimethyl-3,4-dihydro-2H-silin-5-yl)ethoxy]-2-oxoethyl] propanoate
[2-[1-(1,1-dimethyl-3,4-dihydro-2H-silin-5-yl)ethoxy]-2-oxoethyl] propanoate (PubChem CID 132530708) has the molecular formula C14H24O4Si
and a molecular weight of 284.43 g/mol. Its IUPAC name is [2-[1-(1,1-dimethyl-3,4-dihydro-2H-silin-5-yl)ethoxy]-2-oxoethyl] propanoate.
Molecular Properties
| Compound Name | [2-[1-(1,1-dimethyl-3,4-dihydro-2H-silin-5-yl)ethoxy]-2-oxoethyl] propanoate |
| PubChem CID | 132530708 |
| Molecular Formula | C14H24O4Si |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | [2-[1-(1,1-dimethyl-3,4-dihydro-2H-silin-5-yl)ethoxy]-2-oxoethyl] propanoate |
| SMILES | CCC(=O)OCC(=O)OC(C)C1=C[Si](C)(C)CCC1 |
| InChI | InChI=1S/C14H24O4Si/c1-5-13(15)17-9-14(16)18-11(2)12-7-6-8-19(3,4)10-12/h10-11H,5-9H2,1-4H3 |
| InChIKey | HNGQGUOIMUZURA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-[1-(1,1-dimethyl-3,4-dihydro-2H-silin-5-yl)ethoxy]-2-oxoethyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[1-(1,1-dimethyl-3,4-dihydro-2H-silin-5-yl)ethoxy]-2-oxoethyl] propanoate?
The IUPAC name of [2-[1-(1,1-dimethyl-3,4-dihydro-2H-silin-5-yl)ethoxy]-2-oxoethyl] propanoate (CID 132530708) is [2-[1-(1,1-dimethyl-3,4-dihydro-2H-silin-5-yl)ethoxy]-2-oxoethyl] propanoate.
What is the SMILES notation for [2-[1-(1,1-dimethyl-3,4-dihydro-2H-silin-5-yl)ethoxy]-2-oxoethyl] propanoate?
The canonical SMILES for [2-[1-(1,1-dimethyl-3,4-dihydro-2H-silin-5-yl)ethoxy]-2-oxoethyl] propanoate is CCC(=O)OCC(=O)OC(C)C1=C[Si](C)(C)CCC1.
What is the InChIKey of [2-[1-(1,1-dimethyl-3,4-dihydro-2H-silin-5-yl)ethoxy]-2-oxoethyl] propanoate?
The InChIKey is HNGQGUOIMUZURA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O4Si/c1-5-13(15)17-9-14(16)18-11(2)12-7-6-8-19(3,4)10-12/h10-11H,5-9H2,1-4H3.
What are the key properties of [2-[1-(1,1-dimethyl-3,4-dihydro-2H-silin-5-yl)ethoxy]-2-oxoethyl] propanoate?
[2-[1-(1,1-dimethyl-3,4-dihydro-2H-silin-5-yl)ethoxy]-2-oxoethyl] propanoate has a molecular weight of 284.43 g/mol, XLogP of 2.84, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[1-(1,1-dimethyl-3,4-dihydro-2H-silin-5-yl)ethoxy]-2-oxoethyl] propanoate is sourced from PubChem (CID 132530708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).