C12H16FNO — CID 132530885
(2S,3S)-3-(4-fluorophenyl)-2,4-dimethylmorpholine (PubChem CID 132530885) has the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. Its IUPAC name is (2S,3S)-3-(4-fluorophenyl)-2,4-dimethylmorpholine.
| Compound Name | (2S,3S)-3-(4-fluorophenyl)-2,4-dimethylmorpholine |
|---|---|
| PubChem CID | 132530885 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (2S,3S)-3-(4-fluorophenyl)-2,4-dimethylmorpholine |
| SMILES | C[C@@H]1OCCN(C)[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C12H16FNO/c1-9-12(14(2)7-8-15-9)10-3-5-11(13)6-4-10/h3-6,9,12H,7-8H2,1-2H3/t9-,12+/m0/s1 |
| InChIKey | XKPSKYGQMWCTOL-JOYOIKCWSA-N |
| XLogP | 2.22 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |