C30H40N6O5 — CID 132532499
(2S)-2-[3-[[(2S)-2-azido-3-phenylpropanoyl]amino]-5-methyl-2-oxo-1-pyridinyl]-4-methyl-N-[(2S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]-1-oxopentan-2-yl]pentanamide (PubChem CID 132532499) has the molecular formula C30H40N6O5 and a molecular weight of 564.69 g/mol. Its IUPAC name is (2S)-2-[3-[[(2S)-2-azido-3-phenylpropanoyl]amino]-5-methyl-2-oxo-1-pyridinyl]-4-methyl-N-[(2S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]-1-oxopentan-2-yl]pentanamide.
| Compound Name | (2S)-2-[3-[[(2S)-2-azido-3-phenylpropanoyl]amino]-5-methyl-2-oxo-1-pyridinyl]-4-methyl-N-[(2S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]-1-oxopentan-2-yl]pentanamide |
|---|---|
| PubChem CID | 132532499 |
| Molecular Formula | C30H40N6O5 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.31 |
| IUPAC Name | (2S)-2-[3-[[(2S)-2-azido-3-phenylpropanoyl]amino]-5-methyl-2-oxo-1-pyridinyl]-4-methyl-N-[(2S)-4-methyl-1-[(2R)-2-methyloxiran-2-yl]-1-oxopentan-2-yl]pentanamide |
| SMILES | Cc1cc(NC(=O)[C@H](Cc2ccccc2)N=[N+]=[N-])c(=O)n([C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)[C@@]2(C)CO2)c1 |
| InChI | InChI=1S/C30H40N6O5/c1-18(2)12-22(26(37)30(6)17-41-30)32-28(39)25(13-19(3)4)36-16-20(5)14-24(29(36)40)33-27(38)23(34-35-31)15-21-10-8-7-9-11-21/h7-11,14,16,18-19,22-23,25H,12-13,15,17H2,1-6H3,(H,32,39)(H,33,38)/t22-,23-,25-,30+/m0/s1 |
| InChIKey | IXMXSNBWDALEEU-VAVWXBAFSA-N |
| XLogP | 4.49 |
| TPSA | 158.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|