C11H14N2O2 — CID 132532588
5-ethoxy-3-phenyl-5,6-dihydro-2H-1,2,4-oxadiazine (PubChem CID 132532588) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 5-ethoxy-3-phenyl-5,6-dihydro-2H-1,2,4-oxadiazine.
| Compound Name | 5-ethoxy-3-phenyl-5,6-dihydro-2H-1,2,4-oxadiazine |
|---|---|
| PubChem CID | 132532588 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 5-ethoxy-3-phenyl-5,6-dihydro-2H-1,2,4-oxadiazine |
| SMILES | CCOC1CONC(c2ccccc2)=N1 |
| InChI | InChI=1S/C11H14N2O2/c1-2-14-10-8-15-13-11(12-10)9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3,(H,12,13) |
| InChIKey | DNBQBTCDZVFQGM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |