About (2E)-4-acetyl-2-[iodo(phenyl)methylidene]-1',5-dimethylspiro[furan-3,3'-indole]-2'-one
(2E)-4-acetyl-2-[iodo(phenyl)methylidene]-1',5-dimethylspiro[furan-3,3'-indole]-2'-one (PubChem CID 132532784) has the molecular formula C22H18INO3
and a molecular weight of 471.29 g/mol. Its IUPAC name is (2E)-4-acetyl-2-[iodo(phenyl)methylidene]-1',5-dimethylspiro[furan-3,3'-indole]-2'-one.
Molecular Properties
| Compound Name | (2E)-4-acetyl-2-[iodo(phenyl)methylidene]-1',5-dimethylspiro[furan-3,3'-indole]-2'-one |
| PubChem CID | 132532784 |
| Molecular Formula | C22H18INO3 |
| Molecular Weight | 471.29 g/mol |
| Exact Mass | 471.03 |
| IUPAC Name | (2E)-4-acetyl-2-[iodo(phenyl)methylidene]-1',5-dimethylspiro[furan-3,3'-indole]-2'-one |
| SMILES | CC(=O)C1=C(C)O/C(=C(/I)c2ccccc2)C12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C22H18INO3/c1-13(25)18-14(2)27-20(19(23)15-9-5-4-6-10-15)22(18)16-11-7-8-12-17(16)24(3)21(22)26/h4-12H,1-3H3/b20-19+ |
| InChIKey | UVMYRBTZNLHAEZ-FMQUCBEESA-N |
| XLogP | 4.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.29 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2E)-4-acetyl-2-[iodo(phenyl)methylidene]-1',5-dimethylspiro[furan-3,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-4-acetyl-2-[iodo(phenyl)methylidene]-1',5-dimethylspiro[furan-3,3'-indole]-2'-one?
The IUPAC name of (2E)-4-acetyl-2-[iodo(phenyl)methylidene]-1',5-dimethylspiro[furan-3,3'-indole]-2'-one (CID 132532784) is (2E)-4-acetyl-2-[iodo(phenyl)methylidene]-1',5-dimethylspiro[furan-3,3'-indole]-2'-one.
What is the SMILES notation for (2E)-4-acetyl-2-[iodo(phenyl)methylidene]-1',5-dimethylspiro[furan-3,3'-indole]-2'-one?
The canonical SMILES for (2E)-4-acetyl-2-[iodo(phenyl)methylidene]-1',5-dimethylspiro[furan-3,3'-indole]-2'-one is CC(=O)C1=C(C)O/C(=C(/I)c2ccccc2)C12C(=O)N(C)c1ccccc12.
What is the InChIKey of (2E)-4-acetyl-2-[iodo(phenyl)methylidene]-1',5-dimethylspiro[furan-3,3'-indole]-2'-one?
The InChIKey is UVMYRBTZNLHAEZ-FMQUCBEESA-N. The full InChI is InChI=1S/C22H18INO3/c1-13(25)18-14(2)27-20(19(23)15-9-5-4-6-10-15)22(18)16-11-7-8-12-17(16)24(3)21(22)26/h4-12H,1-3H3/b20-19+.
What are the key properties of (2E)-4-acetyl-2-[iodo(phenyl)methylidene]-1',5-dimethylspiro[furan-3,3'-indole]-2'-one?
(2E)-4-acetyl-2-[iodo(phenyl)methylidene]-1',5-dimethylspiro[furan-3,3'-indole]-2'-one has a molecular weight of 471.29 g/mol, XLogP of 4.60, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-4-acetyl-2-[iodo(phenyl)methylidene]-1',5-dimethylspiro[furan-3,3'-indole]-2'-one is sourced from PubChem (CID 132532784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).