C35H44NO3PS — CID 132533090
N-[bis[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]ethyl]phosphinothioyl-(furan-2-yl)methyl]aniline (PubChem CID 132533090) has the molecular formula C35H44NO3PS and a molecular weight of 589.78 g/mol. Its IUPAC name is N-[bis[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]ethyl]phosphinothioyl-(furan-2-yl)methyl]aniline.
| Compound Name | N-[bis[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]ethyl]phosphinothioyl-(furan-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 132533090 |
| Molecular Formula | C35H44NO3PS |
| Molecular Weight | 589.78 g/mol |
| Exact Mass | 589.28 |
| IUPAC Name | N-[bis[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]ethyl]phosphinothioyl-(furan-2-yl)methyl]aniline |
| SMILES | CC(C)(C)Oc1ccc(CCP(=S)(CCc2ccc(OC(C)(C)C)cc2)C(Nc2ccccc2)c2ccco2)cc1 |
| InChI | InChI=1S/C35H44NO3PS/c1-34(2,3)38-30-18-14-27(15-19-30)22-25-40(41,26-23-28-16-20-31(21-17-28)39-35(4,5)6)33(32-13-10-24-37-32)36-29-11-8-7-9-12-29/h7-21,24,33,36H,22-23,25-26H2,1-6H3 |
| InChIKey | OKLCMWBXKSVCND-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.78 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|