C19H29N3O8 — CID 132533124
2-[[4-hydroxy-1,3-bis[(1R,3S)-3-hydroxycyclohexyl]-2,6-dioxo-1,3-diazinane-5-carbonyl]amino]acetic acid (PubChem CID 132533124) has the molecular formula C19H29N3O8 and a molecular weight of 427.45 g/mol. Its IUPAC name is 2-[[4-hydroxy-1,3-bis[(1R,3S)-3-hydroxycyclohexyl]-2,6-dioxo-1,3-diazinane-5-carbonyl]amino]acetic acid.
| Compound Name | 2-[[4-hydroxy-1,3-bis[(1R,3S)-3-hydroxycyclohexyl]-2,6-dioxo-1,3-diazinane-5-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 132533124 |
| Molecular Formula | C19H29N3O8 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 2-[[4-hydroxy-1,3-bis[(1R,3S)-3-hydroxycyclohexyl]-2,6-dioxo-1,3-diazinane-5-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C1C(=O)N([C@@H]2CCC[C@H](O)C2)C(=O)N([C@@H]2CCC[C@H](O)C2)C1O |
| InChI | InChI=1S/C19H29N3O8/c23-12-5-1-3-10(7-12)21-17(28)15(16(27)20-9-14(25)26)18(29)22(19(21)30)11-4-2-6-13(24)8-11/h10-13,15,17,23-24,28H,1-9H2,(H,20,27)(H,25,26)/t10-,11-,12+,13+,15?,17?/m1/s1 |
| InChIKey | KUEZUQWILLGGMO-RDVHJRLNSA-N |
| XLogP | -1.01 |
| TPSA | 167.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|