C24H16F6N2OS — CID 132533196
2-[6-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzofuran-3-yl)cyclopenten-1-yl]-3,5-dimethyl-2-pyridinyl]-1,3-thiazole (PubChem CID 132533196) has the molecular formula C24H16F6N2OS and a molecular weight of 494.46 g/mol. Its IUPAC name is 2-[6-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzofuran-3-yl)cyclopenten-1-yl]-3,5-dimethyl-2-pyridinyl]-1,3-thiazole.
| Compound Name | 2-[6-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzofuran-3-yl)cyclopenten-1-yl]-3,5-dimethyl-2-pyridinyl]-1,3-thiazole |
|---|---|
| PubChem CID | 132533196 |
| Molecular Formula | C24H16F6N2OS |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | 2-[6-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzofuran-3-yl)cyclopenten-1-yl]-3,5-dimethyl-2-pyridinyl]-1,3-thiazole |
| SMILES | Cc1cc(C)c(-c2nccs2)nc1C1=C(c2c(C)oc3ccccc23)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C24H16F6N2OS/c1-11-10-12(2)20(21-31-8-9-34-21)32-19(11)18-17(22(25,26)24(29,30)23(18,27)28)16-13(3)33-15-7-5-4-6-14(15)16/h4-10H,1-3H3 |
| InChIKey | ZSROCMSUYQTPNI-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|