C18H13FO2 — CID 132533237
5-(4-fluorophenyl)-8-methylbenzo[f][1,3]benzodioxole (PubChem CID 132533237) has the molecular formula C18H13FO2 and a molecular weight of 280.30 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-8-methylbenzo[f][1,3]benzodioxole.
| Compound Name | 5-(4-fluorophenyl)-8-methylbenzo[f][1,3]benzodioxole |
|---|---|
| PubChem CID | 132533237 |
| Molecular Formula | C18H13FO2 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 5-(4-fluorophenyl)-8-methylbenzo[f][1,3]benzodioxole |
| SMILES | Cc1ccc(-c2ccc(F)cc2)c2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C18H13FO2/c1-11-2-7-14(12-3-5-13(19)6-4-12)16-9-18-17(8-15(11)16)20-10-21-18/h2-9H,10H2,1H3 |
| InChIKey | QIVJZCHTRRDZTA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |