About 5-(4-fluorophenyl)-8-methylbenzo[f][1,3]benzodioxole
5-(4-fluorophenyl)-8-methylbenzo[f][1,3]benzodioxole (PubChem CID 132533237) has the molecular formula C18H13FO2
and a molecular weight of 280.30 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-8-methylbenzo[f][1,3]benzodioxole.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-8-methylbenzo[f][1,3]benzodioxole |
| PubChem CID | 132533237 |
| Molecular Formula | C18H13FO2 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 5-(4-fluorophenyl)-8-methylbenzo[f][1,3]benzodioxole |
| SMILES | Cc1ccc(-c2ccc(F)cc2)c2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C18H13FO2/c1-11-2-7-14(12-3-5-13(19)6-4-12)16-9-18-17(8-15(11)16)20-10-21-18/h2-9H,10H2,1H3 |
| InChIKey | QIVJZCHTRRDZTA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-fluorophenyl)-8-methylbenzo[f][1,3]benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-8-methylbenzo[f][1,3]benzodioxole?
The IUPAC name of 5-(4-fluorophenyl)-8-methylbenzo[f][1,3]benzodioxole (CID 132533237) is 5-(4-fluorophenyl)-8-methylbenzo[f][1,3]benzodioxole.
What is the SMILES notation for 5-(4-fluorophenyl)-8-methylbenzo[f][1,3]benzodioxole?
The canonical SMILES for 5-(4-fluorophenyl)-8-methylbenzo[f][1,3]benzodioxole is Cc1ccc(-c2ccc(F)cc2)c2cc3c(cc12)OCO3.
What is the InChIKey of 5-(4-fluorophenyl)-8-methylbenzo[f][1,3]benzodioxole?
The InChIKey is QIVJZCHTRRDZTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13FO2/c1-11-2-7-14(12-3-5-13(19)6-4-12)16-9-18-17(8-15(11)16)20-10-21-18/h2-9H,10H2,1H3.
What are the key properties of 5-(4-fluorophenyl)-8-methylbenzo[f][1,3]benzodioxole?
5-(4-fluorophenyl)-8-methylbenzo[f][1,3]benzodioxole has a molecular weight of 280.30 g/mol, XLogP of 4.68, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-8-methylbenzo[f][1,3]benzodioxole is sourced from PubChem (CID 132533237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).