C24H23N3O2 — CID 132533900
N'-(5-methylfuran-2-yl)-4-(1,2,3,4-tetrahydrocarbazol-9-yl)benzohydrazide (PubChem CID 132533900) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is N'-(5-methylfuran-2-yl)-4-(1,2,3,4-tetrahydrocarbazol-9-yl)benzohydrazide.
| Compound Name | N'-(5-methylfuran-2-yl)-4-(1,2,3,4-tetrahydrocarbazol-9-yl)benzohydrazide |
|---|---|
| PubChem CID | 132533900 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N'-(5-methylfuran-2-yl)-4-(1,2,3,4-tetrahydrocarbazol-9-yl)benzohydrazide |
| SMILES | Cc1ccc(NNC(=O)c2ccc(-n3c4c(c5ccccc53)CCCC4)cc2)o1 |
| InChI | InChI=1S/C24H23N3O2/c1-16-10-15-23(29-16)25-26-24(28)17-11-13-18(14-12-17)27-21-8-4-2-6-19(21)20-7-3-5-9-22(20)27/h2,4,6,8,10-15,25H,3,5,7,9H2,1H3,(H,26,28) |
| InChIKey | XGFJGACKQQROOO-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 59.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|