C28H19F5OS — CID 132534081
1,2,3,4,5-pentafluoro-6-[(E)-2-[3-methyl-2-[2-(4-methylphenyl)sulfinylphenyl]phenyl]ethenyl]benzene (PubChem CID 132534081) has the molecular formula C28H19F5OS and a molecular weight of 498.52 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[(E)-2-[3-methyl-2-[2-(4-methylphenyl)sulfinylphenyl]phenyl]ethenyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[(E)-2-[3-methyl-2-[2-(4-methylphenyl)sulfinylphenyl]phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 132534081 |
| Molecular Formula | C28H19F5OS |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[(E)-2-[3-methyl-2-[2-(4-methylphenyl)sulfinylphenyl]phenyl]ethenyl]benzene |
| SMILES | Cc1ccc(S(=O)c2ccccc2-c2c(C)cccc2/C=C/c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C28H19F5OS/c1-16-10-13-19(14-11-16)35(34)22-9-4-3-8-20(22)23-17(2)6-5-7-18(23)12-15-21-24(29)26(31)28(33)27(32)25(21)30/h3-15H,1-2H3/b15-12+ |
| InChIKey | ZVDTTZRRLQVDDW-NTCAYCPXSA-N |
| XLogP | 8.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|