C26H24N2O3 — CID 132534524
ethyl (2S,3aR,9bS)-4-oxo-1,2-diphenyl-2,3,5,9b-tetrahydropyrrolo[3,2-c]quinoline-3a-carboxylate (PubChem CID 132534524) has the molecular formula C26H24N2O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is ethyl (2S,3aR,9bS)-4-oxo-1,2-diphenyl-2,3,5,9b-tetrahydropyrrolo[3,2-c]quinoline-3a-carboxylate.
| Compound Name | ethyl (2S,3aR,9bS)-4-oxo-1,2-diphenyl-2,3,5,9b-tetrahydropyrrolo[3,2-c]quinoline-3a-carboxylate |
|---|---|
| PubChem CID | 132534524 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | ethyl (2S,3aR,9bS)-4-oxo-1,2-diphenyl-2,3,5,9b-tetrahydropyrrolo[3,2-c]quinoline-3a-carboxylate |
| SMILES | CCOC(=O)[C@]12C[C@@H](c3ccccc3)N(c3ccccc3)[C@H]1c1ccccc1NC2=O |
| InChI | InChI=1S/C26H24N2O3/c1-2-31-25(30)26-17-22(18-11-5-3-6-12-18)28(19-13-7-4-8-14-19)23(26)20-15-9-10-16-21(20)27-24(26)29/h3-16,22-23H,2,17H2,1H3,(H,27,29)/t22-,23-,26+/m0/s1 |
| InChIKey | PIIBGFCFMSQEBF-JCYRPKCISA-N |
| XLogP | 4.88 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|