C9H16O3 — CID 132534596
(2S)-1-[(2R,5R)-5-(hydroxymethyl)oxolan-2-yl]but-3-en-2-ol (PubChem CID 132534596) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is (2S)-1-[(2R,5R)-5-(hydroxymethyl)oxolan-2-yl]but-3-en-2-ol.
| Compound Name | (2S)-1-[(2R,5R)-5-(hydroxymethyl)oxolan-2-yl]but-3-en-2-ol |
|---|---|
| PubChem CID | 132534596 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (2S)-1-[(2R,5R)-5-(hydroxymethyl)oxolan-2-yl]but-3-en-2-ol |
| SMILES | C=C[C@@H](O)C[C@H]1CC[C@H](CO)O1 |
| InChI | InChI=1S/C9H16O3/c1-2-7(11)5-8-3-4-9(6-10)12-8/h2,7-11H,1,3-6H2/t7-,8-,9-/m1/s1 |
| InChIKey | AIGFNCGWXQJZIU-IWSPIJDZSA-N |
| XLogP | 0.46 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|