C48H50O2S4 — CID 132534641
4,11-bis[5-[5-(2-ethylhexyl)thiophen-2-yl]thiophen-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-15,16-dione (PubChem CID 132534641) has the molecular formula C48H50O2S4 and a molecular weight of 787.19 g/mol. Its IUPAC name is 4,11-bis[5-[5-(2-ethylhexyl)thiophen-2-yl]thiophen-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-15,16-dione.
| Compound Name | 4,11-bis[5-[5-(2-ethylhexyl)thiophen-2-yl]thiophen-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-15,16-dione |
|---|---|
| PubChem CID | 132534641 |
| Molecular Formula | C48H50O2S4 |
| Molecular Weight | 787.19 g/mol |
| Exact Mass | 786.27 |
| IUPAC Name | 4,11-bis[5-[5-(2-ethylhexyl)thiophen-2-yl]thiophen-2-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-15,16-dione |
| SMILES | CCCCC(CC)Cc1ccc(-c2ccc(-c3ccc4c(c3)C3C(=O)C(=O)C4c4cc(-c5ccc(-c6ccc(CC(CC)CCCC)s6)s5)ccc43)s2)s1 |
| InChI | InChI=1S/C48H50O2S4/c1-5-9-11-29(7-3)25-33-15-19-41(51-33)43-23-21-39(53-43)31-13-17-35-37(27-31)45-36-18-14-32(28-38(36)46(35)48(50)47(45)49)40-22-24-44(54-40)42-20-16-34(52-42)26-30(8-4)12-10-6-2/h13-24,27-30,45-46H,5-12,25-26H2,1-4H3 |
| InChIKey | DJEUELZHCUFTTQ-UHFFFAOYSA-N |
| XLogP | 14.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.19 |
| LogP ≤ 5 | 14.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|