About 6-[(E,3S)-5-hydroxy-3-methylpent-1-enyl]-4-methoxy-3,5-dimethylpyran-2-one
6-[(E,3S)-5-hydroxy-3-methylpent-1-enyl]-4-methoxy-3,5-dimethylpyran-2-one (PubChem CID 132535201) has the molecular formula C14H20O4
and a molecular weight of 252.31 g/mol. Its IUPAC name is 6-[(E,3S)-5-hydroxy-3-methylpent-1-enyl]-4-methoxy-3,5-dimethylpyran-2-one.
Molecular Properties
| Compound Name | 6-[(E,3S)-5-hydroxy-3-methylpent-1-enyl]-4-methoxy-3,5-dimethylpyran-2-one |
| PubChem CID | 132535201 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 6-[(E,3S)-5-hydroxy-3-methylpent-1-enyl]-4-methoxy-3,5-dimethylpyran-2-one |
| SMILES | COc1c(C)c(/C=C/[C@@H](C)CCO)oc(=O)c1C |
| InChI | InChI=1S/C14H20O4/c1-9(7-8-15)5-6-12-10(2)13(17-4)11(3)14(16)18-12/h5-6,9,15H,7-8H2,1-4H3/b6-5+/t9-/m1/s1 |
| InChIKey | UMPCSMLKUFSUIB-VUHVRTRXSA-N |
| XLogP | 2.30 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[(E,3S)-5-hydroxy-3-methylpent-1-enyl]-4-methoxy-3,5-dimethylpyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(E,3S)-5-hydroxy-3-methylpent-1-enyl]-4-methoxy-3,5-dimethylpyran-2-one?
The IUPAC name of 6-[(E,3S)-5-hydroxy-3-methylpent-1-enyl]-4-methoxy-3,5-dimethylpyran-2-one (CID 132535201) is 6-[(E,3S)-5-hydroxy-3-methylpent-1-enyl]-4-methoxy-3,5-dimethylpyran-2-one.
What is the SMILES notation for 6-[(E,3S)-5-hydroxy-3-methylpent-1-enyl]-4-methoxy-3,5-dimethylpyran-2-one?
The canonical SMILES for 6-[(E,3S)-5-hydroxy-3-methylpent-1-enyl]-4-methoxy-3,5-dimethylpyran-2-one is COc1c(C)c(/C=C/[C@@H](C)CCO)oc(=O)c1C.
What is the InChIKey of 6-[(E,3S)-5-hydroxy-3-methylpent-1-enyl]-4-methoxy-3,5-dimethylpyran-2-one?
The InChIKey is UMPCSMLKUFSUIB-VUHVRTRXSA-N. The full InChI is InChI=1S/C14H20O4/c1-9(7-8-15)5-6-12-10(2)13(17-4)11(3)14(16)18-12/h5-6,9,15H,7-8H2,1-4H3/b6-5+/t9-/m1/s1.
What are the key properties of 6-[(E,3S)-5-hydroxy-3-methylpent-1-enyl]-4-methoxy-3,5-dimethylpyran-2-one?
6-[(E,3S)-5-hydroxy-3-methylpent-1-enyl]-4-methoxy-3,5-dimethylpyran-2-one has a molecular weight of 252.31 g/mol, XLogP of 2.30, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(E,3S)-5-hydroxy-3-methylpent-1-enyl]-4-methoxy-3,5-dimethylpyran-2-one is sourced from PubChem (CID 132535201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).