About N-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-2-(trifluoromethyl)benzenesulfonamide
N-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 132535218) has the molecular formula C18H17F3N2O3S
and a molecular weight of 398.41 g/mol. Its IUPAC name is N-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-2-(trifluoromethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-2-(trifluoromethyl)benzenesulfonamide |
| PubChem CID | 132535218 |
| Molecular Formula | C18H17F3N2O3S |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | N-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC1(C)COC(c2ccccc2NS(=O)(=O)c2ccccc2C(F)(F)F)=N1 |
| InChI | InChI=1S/C18H17F3N2O3S/c1-17(2)11-26-16(22-17)12-7-3-5-9-14(12)23-27(24,25)15-10-6-4-8-13(15)18(19,20)21/h3-10,23H,11H2,1-2H3 |
| InChIKey | IQTSUCVJGNRJNX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-2-(trifluoromethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-2-(trifluoromethyl)benzenesulfonamide?
The IUPAC name of N-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-2-(trifluoromethyl)benzenesulfonamide (CID 132535218) is N-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-2-(trifluoromethyl)benzenesulfonamide.
What is the SMILES notation for N-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-2-(trifluoromethyl)benzenesulfonamide?
The canonical SMILES for N-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-2-(trifluoromethyl)benzenesulfonamide is CC1(C)COC(c2ccccc2NS(=O)(=O)c2ccccc2C(F)(F)F)=N1.
What is the InChIKey of N-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-2-(trifluoromethyl)benzenesulfonamide?
The InChIKey is IQTSUCVJGNRJNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F3N2O3S/c1-17(2)11-26-16(22-17)12-7-3-5-9-14(12)23-27(24,25)15-10-6-4-8-13(15)18(19,20)21/h3-10,23H,11H2,1-2H3.
What are the key properties of N-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-2-(trifluoromethyl)benzenesulfonamide?
N-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-2-(trifluoromethyl)benzenesulfonamide has a molecular weight of 398.41 g/mol, XLogP of 4.06, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)phenyl]-2-(trifluoromethyl)benzenesulfonamide is sourced from PubChem (CID 132535218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).