C31H28N2O7S — CID 132536195
methyl (2R,4R,5S)-5-(4-methylphenyl)-3-(4-methylphenyl)sulfonyl-4-(4-nitrophenyl)-2-phenyl-1,3-oxazolidine-5-carboxylate (PubChem CID 132536195) has the molecular formula C31H28N2O7S and a molecular weight of 572.64 g/mol. Its IUPAC name is methyl (2R,4R,5S)-5-(4-methylphenyl)-3-(4-methylphenyl)sulfonyl-4-(4-nitrophenyl)-2-phenyl-1,3-oxazolidine-5-carboxylate.
| Compound Name | methyl (2R,4R,5S)-5-(4-methylphenyl)-3-(4-methylphenyl)sulfonyl-4-(4-nitrophenyl)-2-phenyl-1,3-oxazolidine-5-carboxylate |
|---|---|
| PubChem CID | 132536195 |
| Molecular Formula | C31H28N2O7S |
| Molecular Weight | 572.64 g/mol |
| Exact Mass | 572.16 |
| IUPAC Name | methyl (2R,4R,5S)-5-(4-methylphenyl)-3-(4-methylphenyl)sulfonyl-4-(4-nitrophenyl)-2-phenyl-1,3-oxazolidine-5-carboxylate |
| SMILES | COC(=O)[C@@]1(c2ccc(C)cc2)O[C@H](c2ccccc2)N(S(=O)(=O)c2ccc(C)cc2)[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H28N2O7S/c1-21-9-15-25(16-10-21)31(30(34)39-3)28(23-13-17-26(18-14-23)33(35)36)32(29(40-31)24-7-5-4-6-8-24)41(37,38)27-19-11-22(2)12-20-27/h4-20,28-29H,1-3H3/t28-,29-,31+/m1/s1 |
| InChIKey | HOSDFRNZOXKJNJ-XQKNLLDYSA-N |
| XLogP | 5.74 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.64 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|