About (4R)-2,2-diethyl-4-[4-(trifluoromethyl)phenyl]cyclopentane-1,3-dione
(4R)-2,2-diethyl-4-[4-(trifluoromethyl)phenyl]cyclopentane-1,3-dione (PubChem CID 132536375) has the molecular formula C16H17F3O2
and a molecular weight of 298.30 g/mol. Its IUPAC name is (4R)-2,2-diethyl-4-[4-(trifluoromethyl)phenyl]cyclopentane-1,3-dione.
Molecular Properties
| Compound Name | (4R)-2,2-diethyl-4-[4-(trifluoromethyl)phenyl]cyclopentane-1,3-dione |
| PubChem CID | 132536375 |
| Molecular Formula | C16H17F3O2 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (4R)-2,2-diethyl-4-[4-(trifluoromethyl)phenyl]cyclopentane-1,3-dione |
| SMILES | CCC1(CC)C(=O)C[C@H](c2ccc(C(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C16H17F3O2/c1-3-15(4-2)13(20)9-12(14(15)21)10-5-7-11(8-6-10)16(17,18)19/h5-8,12H,3-4,9H2,1-2H3/t12-/m1/s1 |
| InChIKey | FWLFISNPWNVGKW-GFCCVEGCSA-N |
| XLogP | 4.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (4R)-2,2-diethyl-4-[4-(trifluoromethyl)phenyl]cyclopentane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2,2-diethyl-4-[4-(trifluoromethyl)phenyl]cyclopentane-1,3-dione?
The IUPAC name of (4R)-2,2-diethyl-4-[4-(trifluoromethyl)phenyl]cyclopentane-1,3-dione (CID 132536375) is (4R)-2,2-diethyl-4-[4-(trifluoromethyl)phenyl]cyclopentane-1,3-dione.
What is the SMILES notation for (4R)-2,2-diethyl-4-[4-(trifluoromethyl)phenyl]cyclopentane-1,3-dione?
The canonical SMILES for (4R)-2,2-diethyl-4-[4-(trifluoromethyl)phenyl]cyclopentane-1,3-dione is CCC1(CC)C(=O)C[C@H](c2ccc(C(F)(F)F)cc2)C1=O.
What is the InChIKey of (4R)-2,2-diethyl-4-[4-(trifluoromethyl)phenyl]cyclopentane-1,3-dione?
The InChIKey is FWLFISNPWNVGKW-GFCCVEGCSA-N. The full InChI is InChI=1S/C16H17F3O2/c1-3-15(4-2)13(20)9-12(14(15)21)10-5-7-11(8-6-10)16(17,18)19/h5-8,12H,3-4,9H2,1-2H3/t12-/m1/s1.
What are the key properties of (4R)-2,2-diethyl-4-[4-(trifluoromethyl)phenyl]cyclopentane-1,3-dione?
(4R)-2,2-diethyl-4-[4-(trifluoromethyl)phenyl]cyclopentane-1,3-dione has a molecular weight of 298.30 g/mol, XLogP of 4.14, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2,2-diethyl-4-[4-(trifluoromethyl)phenyl]cyclopentane-1,3-dione is sourced from PubChem (CID 132536375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).