C15H14N2O — CID 132536556
5-methyl-3,5-diphenyl-2H-1,2,4-oxadiazole (PubChem CID 132536556) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 5-methyl-3,5-diphenyl-2H-1,2,4-oxadiazole.
| Compound Name | 5-methyl-3,5-diphenyl-2H-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 132536556 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 5-methyl-3,5-diphenyl-2H-1,2,4-oxadiazole |
| SMILES | CC1(c2ccccc2)N=C(c2ccccc2)NO1 |
| InChI | InChI=1S/C15H14N2O/c1-15(13-10-6-3-7-11-13)16-14(17-18-15)12-8-4-2-5-9-12/h2-11H,1H3,(H,16,17) |
| InChIKey | QDKGZXYMFXPTPX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |