C30H45FO4Si — CID 132537004
propan-2-yl (Z)-7-[(1S,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-2-(4-fluorophenyl)ethenyl]-5-oxocyclohexyl]hept-5-enoate (PubChem CID 132537004) has the molecular formula C30H45FO4Si and a molecular weight of 516.77 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1S,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-2-(4-fluorophenyl)ethenyl]-5-oxocyclohexyl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1S,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-2-(4-fluorophenyl)ethenyl]-5-oxocyclohexyl]hept-5-enoate |
|---|---|
| PubChem CID | 132537004 |
| Molecular Formula | C30H45FO4Si |
| Molecular Weight | 516.77 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | propan-2-yl (Z)-7-[(1S,2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-2-(4-fluorophenyl)ethenyl]-5-oxocyclohexyl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCC/C=C\C[C@H]1CC(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C30H45FO4Si/c1-22(2)34-29(33)13-11-9-8-10-12-24-20-26(32)21-28(35-36(6,7)30(3,4)5)27(24)19-16-23-14-17-25(31)18-15-23/h8,10,14-19,22,24,27-28H,9,11-13,20-21H2,1-7H3/b10-8-,19-16+/t24-,27+,28+/m0/s1 |
| InChIKey | HQXZBEUWOYDICT-CIHCTIQFSA-N |
| XLogP | 7.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.77 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|