C26H26N2O5 — CID 132537034
diethyl (3aR,9aS)-2-benzyl-6-cyano-3-oxo-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate (PubChem CID 132537034) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is diethyl (3aR,9aS)-2-benzyl-6-cyano-3-oxo-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate.
| Compound Name | diethyl (3aR,9aS)-2-benzyl-6-cyano-3-oxo-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate |
|---|---|
| PubChem CID | 132537034 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | diethyl (3aR,9aS)-2-benzyl-6-cyano-3-oxo-1,3a,9,9a-tetrahydrobenzo[f]isoindole-4,4-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)c2cc(C#N)ccc2C[C@@H]2CN(Cc3ccccc3)C(=O)[C@H]21 |
| InChI | InChI=1S/C26H26N2O5/c1-3-32-24(30)26(25(31)33-4-2)21-12-18(14-27)10-11-19(21)13-20-16-28(23(29)22(20)26)15-17-8-6-5-7-9-17/h5-12,20,22H,3-4,13,15-16H2,1-2H3/t20-,22+/m1/s1 |
| InChIKey | GDAVPMKYKJGFPW-IRLDBZIGSA-N |
| XLogP | 2.75 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|