C60H75N3O3 — CID 132538113
N-[4-[2-[3,5-bis[2-[4-(decanoylamino)phenyl]ethynyl]phenyl]ethynyl]phenyl]decanamide (PubChem CID 132538113) has the molecular formula C60H75N3O3 and a molecular weight of 886.28 g/mol. Its IUPAC name is N-[4-[2-[3,5-bis[2-[4-(decanoylamino)phenyl]ethynyl]phenyl]ethynyl]phenyl]decanamide.
| Compound Name | N-[4-[2-[3,5-bis[2-[4-(decanoylamino)phenyl]ethynyl]phenyl]ethynyl]phenyl]decanamide |
|---|---|
| PubChem CID | 132538113 |
| Molecular Formula | C60H75N3O3 |
| Molecular Weight | 886.28 g/mol |
| Exact Mass | 885.58 |
| IUPAC Name | N-[4-[2-[3,5-bis[2-[4-(decanoylamino)phenyl]ethynyl]phenyl]ethynyl]phenyl]decanamide |
| SMILES | CCCCCCCCCC(=O)Nc1ccc(C#Cc2cc(C#Cc3ccc(NC(=O)CCCCCCCCC)cc3)cc(C#Cc3ccc(NC(=O)CCCCCCCCC)cc3)c2)cc1 |
| InChI | InChI=1S/C60H75N3O3/c1-4-7-10-13-16-19-22-25-58(64)61-55-40-34-49(35-41-55)28-31-52-46-53(32-29-50-36-42-56(43-37-50)62-59(65)26-23-20-17-14-11-8-5-2)48-54(47-52)33-30-51-38-44-57(45-39-51)63-60(66)27-24-21-18-15-12-9-6-3/h34-48H,4-27H2,1-3H3,(H,61,64)(H,62,65)(H,63,66) |
| InChIKey | MCXNLEHFEBDIKM-UHFFFAOYSA-N |
| XLogP | 15.12 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.28 |
| LogP ≤ 5 | 15.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|