C18H21BClNO2 — CID 132538371
6-chloro-3-cyclopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline (PubChem CID 132538371) has the molecular formula C18H21BClNO2 and a molecular weight of 329.64 g/mol. Its IUPAC name is 6-chloro-3-cyclopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline.
| Compound Name | 6-chloro-3-cyclopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline |
|---|---|
| PubChem CID | 132538371 |
| Molecular Formula | C18H21BClNO2 |
| Molecular Weight | 329.64 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 6-chloro-3-cyclopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline |
| SMILES | CC1(C)OB(c2c(C3CC3)ncc3ccc(Cl)cc23)OC1(C)C |
| InChI | InChI=1S/C18H21BClNO2/c1-17(2)18(3,4)23-19(22-17)15-14-9-13(20)8-7-12(14)10-21-16(15)11-5-6-11/h7-11H,5-6H2,1-4H3 |
| InChIKey | AUZKMQWIBSTOAF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.64 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|