About (3,3-difluoro-3-phenylpropyl) 4-methyl-1,3-thiazole-5-carboxylate
(3,3-difluoro-3-phenylpropyl) 4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 132538456) has the molecular formula C14H13F2NO2S
and a molecular weight of 297.33 g/mol. Its IUPAC name is (3,3-difluoro-3-phenylpropyl) 4-methyl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | (3,3-difluoro-3-phenylpropyl) 4-methyl-1,3-thiazole-5-carboxylate |
| PubChem CID | 132538456 |
| Molecular Formula | C14H13F2NO2S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | (3,3-difluoro-3-phenylpropyl) 4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1ncsc1C(=O)OCCC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C14H13F2NO2S/c1-10-12(20-9-17-10)13(18)19-8-7-14(15,16)11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3 |
| InChIKey | ILWQVXSJQNXWQB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3,3-difluoro-3-phenylpropyl) 4-methyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-difluoro-3-phenylpropyl) 4-methyl-1,3-thiazole-5-carboxylate?
The IUPAC name of (3,3-difluoro-3-phenylpropyl) 4-methyl-1,3-thiazole-5-carboxylate (CID 132538456) is (3,3-difluoro-3-phenylpropyl) 4-methyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for (3,3-difluoro-3-phenylpropyl) 4-methyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for (3,3-difluoro-3-phenylpropyl) 4-methyl-1,3-thiazole-5-carboxylate is Cc1ncsc1C(=O)OCCC(F)(F)c1ccccc1.
What is the InChIKey of (3,3-difluoro-3-phenylpropyl) 4-methyl-1,3-thiazole-5-carboxylate?
The InChIKey is ILWQVXSJQNXWQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F2NO2S/c1-10-12(20-9-17-10)13(18)19-8-7-14(15,16)11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3.
What are the key properties of (3,3-difluoro-3-phenylpropyl) 4-methyl-1,3-thiazole-5-carboxylate?
(3,3-difluoro-3-phenylpropyl) 4-methyl-1,3-thiazole-5-carboxylate has a molecular weight of 297.33 g/mol, XLogP of 3.79, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-difluoro-3-phenylpropyl) 4-methyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 132538456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).