About 5-(4-methylphenyl)sulfonyl-4-phenyl-3-(1-phenylethenyl)-3,6-dihydro-2H-pyran
5-(4-methylphenyl)sulfonyl-4-phenyl-3-(1-phenylethenyl)-3,6-dihydro-2H-pyran (PubChem CID 132538467) has the molecular formula C26H24O3S
and a molecular weight of 416.54 g/mol. Its IUPAC name is 5-(4-methylphenyl)sulfonyl-4-phenyl-3-(1-phenylethenyl)-3,6-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 5-(4-methylphenyl)sulfonyl-4-phenyl-3-(1-phenylethenyl)-3,6-dihydro-2H-pyran |
| PubChem CID | 132538467 |
| Molecular Formula | C26H24O3S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 5-(4-methylphenyl)sulfonyl-4-phenyl-3-(1-phenylethenyl)-3,6-dihydro-2H-pyran |
| SMILES | C=C(c1ccccc1)C1COCC(S(=O)(=O)c2ccc(C)cc2)=C1c1ccccc1 |
| InChI | InChI=1S/C26H24O3S/c1-19-13-15-23(16-14-19)30(27,28)25-18-29-17-24(20(2)21-9-5-3-6-10-21)26(25)22-11-7-4-8-12-22/h3-16,24H,2,17-18H2,1H3 |
| InChIKey | COJFHWSMGHZEIG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4-methylphenyl)sulfonyl-4-phenyl-3-(1-phenylethenyl)-3,6-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methylphenyl)sulfonyl-4-phenyl-3-(1-phenylethenyl)-3,6-dihydro-2H-pyran?
The IUPAC name of 5-(4-methylphenyl)sulfonyl-4-phenyl-3-(1-phenylethenyl)-3,6-dihydro-2H-pyran (CID 132538467) is 5-(4-methylphenyl)sulfonyl-4-phenyl-3-(1-phenylethenyl)-3,6-dihydro-2H-pyran.
What is the SMILES notation for 5-(4-methylphenyl)sulfonyl-4-phenyl-3-(1-phenylethenyl)-3,6-dihydro-2H-pyran?
The canonical SMILES for 5-(4-methylphenyl)sulfonyl-4-phenyl-3-(1-phenylethenyl)-3,6-dihydro-2H-pyran is C=C(c1ccccc1)C1COCC(S(=O)(=O)c2ccc(C)cc2)=C1c1ccccc1.
What is the InChIKey of 5-(4-methylphenyl)sulfonyl-4-phenyl-3-(1-phenylethenyl)-3,6-dihydro-2H-pyran?
The InChIKey is COJFHWSMGHZEIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24O3S/c1-19-13-15-23(16-14-19)30(27,28)25-18-29-17-24(20(2)21-9-5-3-6-10-21)26(25)22-11-7-4-8-12-22/h3-16,24H,2,17-18H2,1H3.
What are the key properties of 5-(4-methylphenyl)sulfonyl-4-phenyl-3-(1-phenylethenyl)-3,6-dihydro-2H-pyran?
5-(4-methylphenyl)sulfonyl-4-phenyl-3-(1-phenylethenyl)-3,6-dihydro-2H-pyran has a molecular weight of 416.54 g/mol, XLogP of 5.54, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methylphenyl)sulfonyl-4-phenyl-3-(1-phenylethenyl)-3,6-dihydro-2H-pyran is sourced from PubChem (CID 132538467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).