C18H21ClO6 — CID 132538844
(2S)-2-[5-chloro-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]-2-(2,2-dimethylpropanoyloxy)acetic acid (PubChem CID 132538844) has the molecular formula C18H21ClO6 and a molecular weight of 368.81 g/mol. Its IUPAC name is (2S)-2-[5-chloro-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]-2-(2,2-dimethylpropanoyloxy)acetic acid.
| Compound Name | (2S)-2-[5-chloro-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]-2-(2,2-dimethylpropanoyloxy)acetic acid |
|---|---|
| PubChem CID | 132538844 |
| Molecular Formula | C18H21ClO6 |
| Molecular Weight | 368.81 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | (2S)-2-[5-chloro-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]phenyl]-2-(2,2-dimethylpropanoyloxy)acetic acid |
| SMILES | CCOC(=O)/C=C/c1ccc(Cl)cc1[C@H](OC(=O)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C18H21ClO6/c1-5-24-14(20)9-7-11-6-8-12(19)10-13(11)15(16(21)22)25-17(23)18(2,3)4/h6-10,15H,5H2,1-4H3,(H,21,22)/b9-7+/t15-/m0/s1 |
| InChIKey | DFKHZFAWHXODLL-HEWZJLJBSA-N |
| XLogP | 3.63 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.81 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|