About CID 132539326
CID 132539326 (PubChem CID 132539326) has the molecular formula C18H26N3O
and a molecular weight of 300.43 g/mol.
Molecular Properties
| Compound Name | CID 132539326 |
| PubChem CID | 132539326 |
| Molecular Formula | C18H26N3O |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | — |
| SMILES | Cc1cccc(C)c1N=C=NC1CC(C)(C)N([O])C(C)(C)C1 |
| InChI | InChI=1S/C18H26N3O/c1-13-8-7-9-14(2)16(13)20-12-19-15-10-17(3,4)21(22)18(5,6)11-15/h7-9,15H,10-11H2,1-6H3 |
| InChIKey | OASWRDGRCJVPKZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 47.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 132539326 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 132539326?
The IUPAC name of CID 132539326 (CID 132539326) is not available.
What is the SMILES notation for CID 132539326?
The canonical SMILES for CID 132539326 is Cc1cccc(C)c1N=C=NC1CC(C)(C)N([O])C(C)(C)C1.
What is the InChIKey of CID 132539326?
The InChIKey is OASWRDGRCJVPKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N3O/c1-13-8-7-9-14(2)16(13)20-12-19-15-10-17(3,4)21(22)18(5,6)11-15/h7-9,15H,10-11H2,1-6H3.
What are the key properties of CID 132539326?
CID 132539326 has a molecular weight of 300.43 g/mol, XLogP of 4.48, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 132539326 is sourced from PubChem (CID 132539326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).