About 3-[(Z)-but-2-enyl]-1,3-oxazolidin-2-one
3-[(Z)-but-2-enyl]-1,3-oxazolidin-2-one (PubChem CID 132539503) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is 3-[(Z)-but-2-enyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-[(Z)-but-2-enyl]-1,3-oxazolidin-2-one |
| PubChem CID | 132539503 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 3-[(Z)-but-2-enyl]-1,3-oxazolidin-2-one |
| SMILES | C/C=C\CN1CCOC1=O |
| InChI | InChI=1S/C7H11NO2/c1-2-3-4-8-5-6-10-7(8)9/h2-3H,4-6H2,1H3/b3-2- |
| InChIKey | JXRCVEDIMKKGFO-IHWYPQMZSA-N |
| XLogP | 1.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(Z)-but-2-enyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-but-2-enyl]-1,3-oxazolidin-2-one?
The IUPAC name of 3-[(Z)-but-2-enyl]-1,3-oxazolidin-2-one (CID 132539503) is 3-[(Z)-but-2-enyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-[(Z)-but-2-enyl]-1,3-oxazolidin-2-one?
The canonical SMILES for 3-[(Z)-but-2-enyl]-1,3-oxazolidin-2-one is C/C=C\CN1CCOC1=O.
What is the InChIKey of 3-[(Z)-but-2-enyl]-1,3-oxazolidin-2-one?
The InChIKey is JXRCVEDIMKKGFO-IHWYPQMZSA-N. The full InChI is InChI=1S/C7H11NO2/c1-2-3-4-8-5-6-10-7(8)9/h2-3H,4-6H2,1H3/b3-2-.
What are the key properties of 3-[(Z)-but-2-enyl]-1,3-oxazolidin-2-one?
3-[(Z)-but-2-enyl]-1,3-oxazolidin-2-one has a molecular weight of 141.17 g/mol, XLogP of 1.01, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-but-2-enyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 132539503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).