About CID 132539732
CID 132539732 (PubChem CID 132539732) has the molecular formula C18H15N3O6P3+3
and a molecular weight of 462.26 g/mol.
Molecular Properties
| Compound Name | CID 132539732 |
| PubChem CID | 132539732 |
| Molecular Formula | C18H15N3O6P3+3 |
| Molecular Weight | 462.26 g/mol |
| Exact Mass | 462.02 |
| IUPAC Name | — |
| SMILES | c1ccc2c(c1)O[P+]1(N[P+]3(N[P+]4(N1)Oc1ccccc1O4)Oc1ccccc1O3)O2 |
| InChI | InChI=1S/C18H15N3O6P3/c1-2-8-14-13(7-1)22-28(23-14)19-29(24-15-9-3-4-10-16(15)25-29)21-30(20-28)26-17-11-5-6-12-18(17)27-30/h1-12,19-21H/q+3 |
| InChIKey | VSONVARZRJLTEA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 91.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.26 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 132539732 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 132539732?
The IUPAC name of CID 132539732 (CID 132539732) is not available.
What is the SMILES notation for CID 132539732?
The canonical SMILES for CID 132539732 is c1ccc2c(c1)O[P+]1(N[P+]3(N[P+]4(N1)Oc1ccccc1O4)Oc1ccccc1O3)O2.
What is the InChIKey of CID 132539732?
The InChIKey is VSONVARZRJLTEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3O6P3/c1-2-8-14-13(7-1)22-28(23-14)19-29(24-15-9-3-4-10-16(15)25-29)21-30(20-28)26-17-11-5-6-12-18(17)27-30/h1-12,19-21H/q+3.
What are the key properties of CID 132539732?
CID 132539732 has a molecular weight of 462.26 g/mol, XLogP of 5.22, 0 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 132539732 is sourced from PubChem (CID 132539732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).