C23H18F8NO2+ — CID 132540065
trimethyl-[[2-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methoxyphenyl)phenoxy]phenyl]methyl]azanium (PubChem CID 132540065) has the molecular formula C23H18F8NO2+ and a molecular weight of 492.39 g/mol. Its IUPAC name is trimethyl-[[2-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methoxyphenyl)phenoxy]phenyl]methyl]azanium.
| Compound Name | trimethyl-[[2-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methoxyphenyl)phenoxy]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 132540065 |
| Molecular Formula | C23H18F8NO2+ |
| Molecular Weight | 492.39 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | trimethyl-[[2-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methoxyphenyl)phenoxy]phenyl]methyl]azanium |
| SMILES | COc1c(F)c(F)c(-c2c(F)c(F)c(Oc3ccccc3C[N+](C)(C)C)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C23H18F8NO2/c1-32(2,3)9-10-7-5-6-8-11(10)34-23-20(30)16(26)13(17(27)21(23)31)12-14(24)18(28)22(33-4)19(29)15(12)25/h5-8H,9H2,1-4H3/q+1 |
| InChIKey | XJIUKRMKLJNSIO-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.39 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|