About 1,3-dimethyl-2-(4-methylphenyl)-2,4-dihydroquinazoline
1,3-dimethyl-2-(4-methylphenyl)-2,4-dihydroquinazoline (PubChem CID 132540170) has the molecular formula C17H20N2
and a molecular weight of 252.36 g/mol. Its IUPAC name is 1,3-dimethyl-2-(4-methylphenyl)-2,4-dihydroquinazoline.
Molecular Properties
| Compound Name | 1,3-dimethyl-2-(4-methylphenyl)-2,4-dihydroquinazoline |
| PubChem CID | 132540170 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 1,3-dimethyl-2-(4-methylphenyl)-2,4-dihydroquinazoline |
| SMILES | Cc1ccc(C2N(C)Cc3ccccc3N2C)cc1 |
| InChI | InChI=1S/C17H20N2/c1-13-8-10-14(11-9-13)17-18(2)12-15-6-4-5-7-16(15)19(17)3/h4-11,17H,12H2,1-3H3 |
| InChIKey | XIYDJURJHKTYIO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-dimethyl-2-(4-methylphenyl)-2,4-dihydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-2-(4-methylphenyl)-2,4-dihydroquinazoline?
The IUPAC name of 1,3-dimethyl-2-(4-methylphenyl)-2,4-dihydroquinazoline (CID 132540170) is 1,3-dimethyl-2-(4-methylphenyl)-2,4-dihydroquinazoline.
What is the SMILES notation for 1,3-dimethyl-2-(4-methylphenyl)-2,4-dihydroquinazoline?
The canonical SMILES for 1,3-dimethyl-2-(4-methylphenyl)-2,4-dihydroquinazoline is Cc1ccc(C2N(C)Cc3ccccc3N2C)cc1.
What is the InChIKey of 1,3-dimethyl-2-(4-methylphenyl)-2,4-dihydroquinazoline?
The InChIKey is XIYDJURJHKTYIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2/c1-13-8-10-14(11-9-13)17-18(2)12-15-6-4-5-7-16(15)19(17)3/h4-11,17H,12H2,1-3H3.
What are the key properties of 1,3-dimethyl-2-(4-methylphenyl)-2,4-dihydroquinazoline?
1,3-dimethyl-2-(4-methylphenyl)-2,4-dihydroquinazoline has a molecular weight of 252.36 g/mol, XLogP of 3.58, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-2-(4-methylphenyl)-2,4-dihydroquinazoline is sourced from PubChem (CID 132540170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).