C33H23NO5 — CID 132540214
18-nona-1,8-dien-5-yl-7-oxa-18-azaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone (PubChem CID 132540214) has the molecular formula C33H23NO5 and a molecular weight of 513.55 g/mol. Its IUPAC name is 18-nona-1,8-dien-5-yl-7-oxa-18-azaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone.
| Compound Name | 18-nona-1,8-dien-5-yl-7-oxa-18-azaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone |
|---|---|
| PubChem CID | 132540214 |
| Molecular Formula | C33H23NO5 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | 18-nona-1,8-dien-5-yl-7-oxa-18-azaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone |
| SMILES | C=CCCC(CCC=C)N1C(=O)c2ccc3c4ccc5c6c(ccc(c7ccc(c2c37)C1=O)c64)C(=O)OC5=O |
| InChI | InChI=1S/C33H23NO5/c1-3-5-7-17(8-6-4-2)34-30(35)22-13-9-18-20-11-15-24-29-25(33(38)39-32(24)37)16-12-21(27(20)29)19-10-14-23(31(34)36)28(22)26(18)19/h3-4,9-17H,1-2,5-8H2 |
| InChIKey | XRMVVDWWAGQIGL-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|