C18H16F3NO2 — CID 132540292
3-benzyl-5-phenyl-5-(2,2,2-trifluoroethyl)-1,3-oxazolidin-2-one (PubChem CID 132540292) has the molecular formula C18H16F3NO2 and a molecular weight of 335.32 g/mol. Its IUPAC name is 3-benzyl-5-phenyl-5-(2,2,2-trifluoroethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-benzyl-5-phenyl-5-(2,2,2-trifluoroethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 132540292 |
| Molecular Formula | C18H16F3NO2 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 3-benzyl-5-phenyl-5-(2,2,2-trifluoroethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(CC(F)(F)F)(c2ccccc2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C18H16F3NO2/c19-18(20,21)12-17(15-9-5-2-6-10-15)13-22(16(23)24-17)11-14-7-3-1-4-8-14/h1-10H,11-13H2 |
| InChIKey | GWAVCMHPYJCFEJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |