C18H16BF2NO — CID 132540460
9,9-difluoro-17-methyl-17-prop-2-enyl-8-oxa-10-azonia-9-boranuidatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11,13,15-heptaene (PubChem CID 132540460) has the molecular formula C18H16BF2NO and a molecular weight of 311.14 g/mol. Its IUPAC name is 9,9-difluoro-17-methyl-17-prop-2-enyl-8-oxa-10-azonia-9-boranuidatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11,13,15-heptaene.
| Compound Name | 9,9-difluoro-17-methyl-17-prop-2-enyl-8-oxa-10-azonia-9-boranuidatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11,13,15-heptaene |
|---|---|
| PubChem CID | 132540460 |
| Molecular Formula | C18H16BF2NO |
| Molecular Weight | 311.14 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 9,9-difluoro-17-methyl-17-prop-2-enyl-8-oxa-10-azonia-9-boranuidatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,11,13,15-heptaene |
| SMILES | C=CCC1(C)C2=[N+](c3ccccc31)[B-](F)(F)Oc1ccccc12 |
| InChI | InChI=1S/C18H16BF2NO/c1-3-12-18(2)14-9-5-6-10-15(14)22-17(18)13-8-4-7-11-16(13)23-19(22,20)21/h3-11H,1,12H2,2H3 |
| InChIKey | DDGOACFTKFXSIT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.14 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|