C21H23NO — CID 132541244
(3R,8aR)-3-[2-(6-methoxynaphthalen-2-yl)ethynyl]-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 132541244) has the molecular formula C21H23NO and a molecular weight of 305.42 g/mol. Its IUPAC name is (3R,8aR)-3-[2-(6-methoxynaphthalen-2-yl)ethynyl]-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | (3R,8aR)-3-[2-(6-methoxynaphthalen-2-yl)ethynyl]-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 132541244 |
| Molecular Formula | C21H23NO |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | (3R,8aR)-3-[2-(6-methoxynaphthalen-2-yl)ethynyl]-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | COc1ccc2cc(C#C[C@H]3CC[C@H]4CCCCN43)ccc2c1 |
| InChI | InChI=1S/C21H23NO/c1-23-21-12-8-17-14-16(5-7-18(17)15-21)6-9-20-11-10-19-4-2-3-13-22(19)20/h5,7-8,12,14-15,19-20H,2-4,10-11,13H2,1H3/t19-,20+/m1/s1 |
| InChIKey | WICMNFUDZUQNEF-UXHICEINSA-N |
| XLogP | 4.22 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|