C31H50O4 — CID 132541486
(1S,3R,6R,7R,10R,11S,16R)-10-hydroxy-6-[(2S,3R)-3-hydroxy-6-methyl-5-methylideneheptan-2-yl]-3,7,11,15,15-pentamethyltetracyclo[8.7.0.03,7.011,16]heptadecane-2,14-dione (PubChem CID 132541486) has the molecular formula C31H50O4 and a molecular weight of 486.74 g/mol. Its IUPAC name is (1S,3R,6R,7R,10R,11S,16R)-10-hydroxy-6-[(2S,3R)-3-hydroxy-6-methyl-5-methylideneheptan-2-yl]-3,7,11,15,15-pentamethyltetracyclo[8.7.0.03,7.011,16]heptadecane-2,14-dione.
| Compound Name | (1S,3R,6R,7R,10R,11S,16R)-10-hydroxy-6-[(2S,3R)-3-hydroxy-6-methyl-5-methylideneheptan-2-yl]-3,7,11,15,15-pentamethyltetracyclo[8.7.0.03,7.011,16]heptadecane-2,14-dione |
|---|---|
| PubChem CID | 132541486 |
| Molecular Formula | C31H50O4 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.37 |
| IUPAC Name | (1S,3R,6R,7R,10R,11S,16R)-10-hydroxy-6-[(2S,3R)-3-hydroxy-6-methyl-5-methylideneheptan-2-yl]-3,7,11,15,15-pentamethyltetracyclo[8.7.0.03,7.011,16]heptadecane-2,14-dione |
| SMILES | C=C(C[C@@H](O)[C@@H](C)[C@H]1CC[C@@]2(C)C(=O)[C@H]3C[C@H]4C(C)(C)C(=O)CC[C@]4(C)[C@@]3(O)CC[C@]12C)C(C)C |
| InChI | InChI=1S/C31H50O4/c1-18(2)19(3)16-23(32)20(4)21-10-12-30(9)26(34)22-17-24-27(5,6)25(33)11-13-29(24,8)31(22,35)15-14-28(21,30)7/h18,20-24,32,35H,3,10-17H2,1-2,4-9H3/t20-,21+,22+,23+,24-,28+,29-,30-,31+/m0/s1 |
| InChIKey | TYWVGHJFBRRSAC-BOGMEMAHSA-N |
| XLogP | 6.13 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|