C18H11Cl2N3 — CID 132541945
11-(2,4-dichlorophenyl)-3,4,10-triazatetracyclo[7.6.0.02,6.012,15]pentadeca-1(9),2(6),4,7,10,12(15)-hexaene (PubChem CID 132541945) has the molecular formula C18H11Cl2N3 and a molecular weight of 340.21 g/mol. Its IUPAC name is 11-(2,4-dichlorophenyl)-3,4,10-triazatetracyclo[7.6.0.02,6.012,15]pentadeca-1(9),2(6),4,7,10,12(15)-hexaene.
| Compound Name | 11-(2,4-dichlorophenyl)-3,4,10-triazatetracyclo[7.6.0.02,6.012,15]pentadeca-1(9),2(6),4,7,10,12(15)-hexaene |
|---|---|
| PubChem CID | 132541945 |
| Molecular Formula | C18H11Cl2N3 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 11-(2,4-dichlorophenyl)-3,4,10-triazatetracyclo[7.6.0.02,6.012,15]pentadeca-1(9),2(6),4,7,10,12(15)-hexaene |
| SMILES | Clc1ccc(-c2nc3ccc4cn[nH]c4c3c3c2CC3)c(Cl)c1 |
| InChI | InChI=1S/C18H11Cl2N3/c19-10-2-3-13(14(20)7-10)18-12-5-4-11(12)16-15(22-18)6-1-9-8-21-23-17(9)16/h1-3,6-8H,4-5H2,(H,21,23) |
| InChIKey | DQBGBTKYZMGLEF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |